C18H18N2O6S — CID 8567125
[2-[(2R)-2-methyl-1-methylsulfonyl-2,3-dihydroindol-5-yl]-2-oxoethyl] 1-oxidopyridin-1-ium-2-carboxylate (PubChem CID 8567125) has the molecular formula C18H18N2O6S and a molecular weight of 390.42 g/mol. Its IUPAC name is [2-[(2R)-2-methyl-1-methylsulfonyl-2,3-dihydroindol-5-yl]-2-oxoethyl] 1-oxidopyridin-1-ium-2-carboxylate.
| Compound Name | [2-[(2R)-2-methyl-1-methylsulfonyl-2,3-dihydroindol-5-yl]-2-oxoethyl] 1-oxidopyridin-1-ium-2-carboxylate |
|---|---|
| PubChem CID | 8567125 |
| Molecular Formula | C18H18N2O6S |
| Molecular Weight | 390.42 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | [2-[(2R)-2-methyl-1-methylsulfonyl-2,3-dihydroindol-5-yl]-2-oxoethyl] 1-oxidopyridin-1-ium-2-carboxylate |
| SMILES | C[C@@H]1Cc2cc(C(=O)COC(=O)c3cccc[n+]3[O-])ccc2N1S(C)(=O)=O |
| InChI | InChI=1S/C18H18N2O6S/c1-12-9-14-10-13(6-7-15(14)20(12)27(2,24)25)17(21)11-26-18(22)16-5-3-4-8-19(16)23/h3-8,10,12H,9,11H2,1-2H3/t12-/m1/s1 |
| InChIKey | MAZLOSSARVTFKR-GFCCVEGCSA-N |
| XLogP | 1.07 |
| TPSA | 107.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.42 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|