About [2-oxo-2-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)ethyl] 5-fluoro-3-methyl-1-benzofuran-2-carboxylate
[2-oxo-2-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)ethyl] 5-fluoro-3-methyl-1-benzofuran-2-carboxylate (PubChem CID 8567361) has the molecular formula C23H20FNO4
and a molecular weight of 393.41 g/mol. Its IUPAC name is [2-oxo-2-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)ethyl] 5-fluoro-3-methyl-1-benzofuran-2-carboxylate.
Molecular Properties
| Compound Name | [2-oxo-2-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)ethyl] 5-fluoro-3-methyl-1-benzofuran-2-carboxylate |
| PubChem CID | 8567361 |
| Molecular Formula | C23H20FNO4 |
| Molecular Weight | 393.41 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | [2-oxo-2-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)ethyl] 5-fluoro-3-methyl-1-benzofuran-2-carboxylate |
| SMILES | Cc1c(C(=O)OCC(=O)N2CC=C(c3ccccc3)CC2)oc2ccc(F)cc12 |
| InChI | InChI=1S/C23H20FNO4/c1-15-19-13-18(24)7-8-20(19)29-22(15)23(27)28-14-21(26)25-11-9-17(10-12-25)16-5-3-2-4-6-16/h2-9,13H,10-12,14H2,1H3 |
| InChIKey | BCZTXUHCAXKUBI-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.41 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-oxo-2-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)ethyl] 5-fluoro-3-methyl-1-benzofuran-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-oxo-2-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)ethyl] 5-fluoro-3-methyl-1-benzofuran-2-carboxylate?
The IUPAC name of [2-oxo-2-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)ethyl] 5-fluoro-3-methyl-1-benzofuran-2-carboxylate (CID 8567361) is [2-oxo-2-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)ethyl] 5-fluoro-3-methyl-1-benzofuran-2-carboxylate.
What is the SMILES notation for [2-oxo-2-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)ethyl] 5-fluoro-3-methyl-1-benzofuran-2-carboxylate?
The canonical SMILES for [2-oxo-2-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)ethyl] 5-fluoro-3-methyl-1-benzofuran-2-carboxylate is Cc1c(C(=O)OCC(=O)N2CC=C(c3ccccc3)CC2)oc2ccc(F)cc12.
What is the InChIKey of [2-oxo-2-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)ethyl] 5-fluoro-3-methyl-1-benzofuran-2-carboxylate?
The InChIKey is BCZTXUHCAXKUBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H20FNO4/c1-15-19-13-18(24)7-8-20(19)29-22(15)23(27)28-14-21(26)25-11-9-17(10-12-25)16-5-3-2-4-6-16/h2-9,13H,10-12,14H2,1H3.
What are the key properties of [2-oxo-2-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)ethyl] 5-fluoro-3-methyl-1-benzofuran-2-carboxylate?
[2-oxo-2-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)ethyl] 5-fluoro-3-methyl-1-benzofuran-2-carboxylate has a molecular weight of 393.41 g/mol, XLogP of 4.35, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-oxo-2-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)ethyl] 5-fluoro-3-methyl-1-benzofuran-2-carboxylate is sourced from PubChem (CID 8567361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).