C21H31N3O4 — CID 8567619
N-butyl-N-ethyl-2-[(4R)-4-[2-(4-methoxyphenyl)ethyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 8567619) has the molecular formula C21H31N3O4 and a molecular weight of 389.50 g/mol. Its IUPAC name is N-butyl-N-ethyl-2-[(4R)-4-[2-(4-methoxyphenyl)ethyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-butyl-N-ethyl-2-[(4R)-4-[2-(4-methoxyphenyl)ethyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 8567619 |
| Molecular Formula | C21H31N3O4 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.23 |
| IUPAC Name | N-butyl-N-ethyl-2-[(4R)-4-[2-(4-methoxyphenyl)ethyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | CCCCN(CC)C(=O)CN1C(=O)N[C@](C)(CCc2ccc(OC)cc2)C1=O |
| InChI | InChI=1S/C21H31N3O4/c1-5-7-14-23(6-2)18(25)15-24-19(26)21(3,22-20(24)27)13-12-16-8-10-17(28-4)11-9-16/h8-11H,5-7,12-15H2,1-4H3,(H,22,27)/t21-/m1/s1 |
| InChIKey | ATTVQYZFIBCYDC-OAQYLSRUSA-N |
| XLogP | 2.59 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|