C19H18ClNO7 — CID 8567777
[2-[2-(2-methoxyphenoxy)ethylamino]-2-oxoethyl] 7-chloro-1,3-benzodioxole-5-carboxylate (PubChem CID 8567777) has the molecular formula C19H18ClNO7 and a molecular weight of 407.81 g/mol. Its IUPAC name is [2-[2-(2-methoxyphenoxy)ethylamino]-2-oxoethyl] 7-chloro-1,3-benzodioxole-5-carboxylate.
| Compound Name | [2-[2-(2-methoxyphenoxy)ethylamino]-2-oxoethyl] 7-chloro-1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 8567777 |
| Molecular Formula | C19H18ClNO7 |
| Molecular Weight | 407.81 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | [2-[2-(2-methoxyphenoxy)ethylamino]-2-oxoethyl] 7-chloro-1,3-benzodioxole-5-carboxylate |
| SMILES | COc1ccccc1OCCNC(=O)COC(=O)c1cc(Cl)c2c(c1)OCO2 |
| InChI | InChI=1S/C19H18ClNO7/c1-24-14-4-2-3-5-15(14)25-7-6-21-17(22)10-26-19(23)12-8-13(20)18-16(9-12)27-11-28-18/h2-5,8-9H,6-7,10-11H2,1H3,(H,21,22) |
| InChIKey | UABZVODTUQOKBV-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.81 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|