C17H15N3O2S — CID 8570389
2-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl benzoate (PubChem CID 8570389) has the molecular formula C17H15N3O2S and a molecular weight of 325.39 g/mol. Its IUPAC name is 2-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl benzoate.
| Compound Name | 2-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl benzoate |
|---|---|
| PubChem CID | 8570389 |
| Molecular Formula | C17H15N3O2S |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | 2-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl benzoate |
| SMILES | O=C(OCCSc1n[nH]c(-c2ccccc2)n1)c1ccccc1 |
| InChI | InChI=1S/C17H15N3O2S/c21-16(14-9-5-2-6-10-14)22-11-12-23-17-18-15(19-20-17)13-7-3-1-4-8-13/h1-10H,11-12H2,(H,18,19,20) |
| InChIKey | YTKLVQYRTQDDNA-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|