C20H24FNO2 — CID 8571270
(2S)-2-(4-tert-butylphenoxy)-N-[(2-fluorophenyl)methyl]propanamide (PubChem CID 8571270) has the molecular formula C20H24FNO2 and a molecular weight of 329.42 g/mol. Its IUPAC name is (2S)-2-(4-tert-butylphenoxy)-N-[(2-fluorophenyl)methyl]propanamide.
| Compound Name | (2S)-2-(4-tert-butylphenoxy)-N-[(2-fluorophenyl)methyl]propanamide |
|---|---|
| PubChem CID | 8571270 |
| Molecular Formula | C20H24FNO2 |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.18 |
| IUPAC Name | (2S)-2-(4-tert-butylphenoxy)-N-[(2-fluorophenyl)methyl]propanamide |
| SMILES | C[C@H](Oc1ccc(C(C)(C)C)cc1)C(=O)NCc1ccccc1F |
| InChI | InChI=1S/C20H24FNO2/c1-14(19(23)22-13-15-7-5-6-8-18(15)21)24-17-11-9-16(10-12-17)20(2,3)4/h5-12,14H,13H2,1-4H3,(H,22,23)/t14-/m0/s1 |
| InChIKey | WVNVAQZICYGYRU-AWEZNQCLSA-N |
| XLogP | 4.21 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |