C24H27N3O2S — CID 8573311
3-[2-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-oxoethyl]-5-(4-methylphenyl)thieno[2,3-d]pyrimidin-4-one (PubChem CID 8573311) has the molecular formula C24H27N3O2S and a molecular weight of 421.57 g/mol. Its IUPAC name is 3-[2-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-oxoethyl]-5-(4-methylphenyl)thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 3-[2-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-oxoethyl]-5-(4-methylphenyl)thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 8573311 |
| Molecular Formula | C24H27N3O2S |
| Molecular Weight | 421.57 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | 3-[2-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-oxoethyl]-5-(4-methylphenyl)thieno[2,3-d]pyrimidin-4-one |
| SMILES | Cc1ccc(-c2csc3ncn(CC(=O)N4CC[C@H]5CCCC[C@H]5C4)c(=O)c23)cc1 |
| InChI | InChI=1S/C24H27N3O2S/c1-16-6-8-18(9-7-16)20-14-30-23-22(20)24(29)27(15-25-23)13-21(28)26-11-10-17-4-2-3-5-19(17)12-26/h6-9,14-15,17,19H,2-5,10-13H2,1H3/t17-,19+/m1/s1 |
| InChIKey | JFDTWYXBMJEELW-MJGOQNOKSA-N |
| XLogP | 4.47 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.57 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |