C11H13N3OS — CID 857446
N-ethyl-5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-amine (PubChem CID 857446) has the molecular formula C11H13N3OS and a molecular weight of 235.31 g/mol. Its IUPAC name is N-ethyl-5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-amine.
| Compound Name | N-ethyl-5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 857446 |
| Molecular Formula | C11H13N3OS |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | N-ethyl-5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-amine |
| SMILES | CCNc1nnc(-c2ccc(OC)cc2)s1 |
| InChI | InChI=1S/C11H13N3OS/c1-3-12-11-14-13-10(16-11)8-4-6-9(15-2)7-5-8/h4-7H,3H2,1-2H3,(H,12,14) |
| InChIKey | YDFONPQESSGLCZ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |