C22H28N4O2S — CID 8575349
2-[[4-benzyl-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(2S)-heptan-2-yl]acetamide (PubChem CID 8575349) has the molecular formula C22H28N4O2S and a molecular weight of 412.56 g/mol. Its IUPAC name is 2-[[4-benzyl-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(2S)-heptan-2-yl]acetamide.
| Compound Name | 2-[[4-benzyl-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(2S)-heptan-2-yl]acetamide |
|---|---|
| PubChem CID | 8575349 |
| Molecular Formula | C22H28N4O2S |
| Molecular Weight | 412.56 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | 2-[[4-benzyl-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(2S)-heptan-2-yl]acetamide |
| SMILES | CCCCC[C@H](C)NC(=O)CSc1nnc(-c2ccco2)n1Cc1ccccc1 |
| InChI | InChI=1S/C22H28N4O2S/c1-3-4-6-10-17(2)23-20(27)16-29-22-25-24-21(19-13-9-14-28-19)26(22)15-18-11-7-5-8-12-18/h5,7-9,11-14,17H,3-4,6,10,15-16H2,1-2H3,(H,23,27)/t17-/m0/s1 |
| InChIKey | XLPYBKVRRMNCBS-KRWDZBQOSA-N |
| XLogP | 4.76 |
| TPSA | 72.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.56 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|