C17H13Cl2NO2S — CID 8575723
5-[2-(2,6-dichlorophenyl)sulfanylacetyl]-1-methyl-3H-indol-2-one (PubChem CID 8575723) has the molecular formula C17H13Cl2NO2S and a molecular weight of 366.27 g/mol. Its IUPAC name is 5-[2-(2,6-dichlorophenyl)sulfanylacetyl]-1-methyl-3H-indol-2-one.
| Compound Name | 5-[2-(2,6-dichlorophenyl)sulfanylacetyl]-1-methyl-3H-indol-2-one |
|---|---|
| PubChem CID | 8575723 |
| Molecular Formula | C17H13Cl2NO2S |
| Molecular Weight | 366.27 g/mol |
| Exact Mass | 365.00 |
| IUPAC Name | 5-[2-(2,6-dichlorophenyl)sulfanylacetyl]-1-methyl-3H-indol-2-one |
| SMILES | CN1C(=O)Cc2cc(C(=O)CSc3c(Cl)cccc3Cl)ccc21 |
| InChI | InChI=1S/C17H13Cl2NO2S/c1-20-14-6-5-10(7-11(14)8-16(20)22)15(21)9-23-17-12(18)3-2-4-13(17)19/h2-7H,8-9H2,1H3 |
| InChIKey | MGVZCNCOGCUQEF-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.27 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |