C19H26N2OS — CID 857618
2-(3-ethylquinolin-2-yl)sulfanyl-N,N-di(propan-2-yl)acetamide (PubChem CID 857618) has the molecular formula C19H26N2OS and a molecular weight of 330.50 g/mol. Its IUPAC name is 2-(3-ethylquinolin-2-yl)sulfanyl-N,N-di(propan-2-yl)acetamide.
| Compound Name | 2-(3-ethylquinolin-2-yl)sulfanyl-N,N-di(propan-2-yl)acetamide |
|---|---|
| PubChem CID | 857618 |
| Molecular Formula | C19H26N2OS |
| Molecular Weight | 330.50 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | 2-(3-ethylquinolin-2-yl)sulfanyl-N,N-di(propan-2-yl)acetamide |
| SMILES | CCc1cc2ccccc2nc1SCC(=O)N(C(C)C)C(C)C |
| InChI | InChI=1S/C19H26N2OS/c1-6-15-11-16-9-7-8-10-17(16)20-19(15)23-12-18(22)21(13(2)3)14(4)5/h7-11,13-14H,6,12H2,1-5H3 |
| InChIKey | GAPXCFYRUZDINJ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.50 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |