C14H16ClNO5S — CID 85781811
1-(5-Phenyl-1,3-oxathiol-2-ylidene)piperidin-1-ium perchlorate (PubChem CID 85781811) has the molecular formula C14H16ClNO5S and a molecular weight of 345.80 g/mol. Its IUPAC name is 1-(5-phenyl-1,3-oxathiol-2-ylidene)piperidin-1-ium perchlorate.
| Compound Name | 1-(5-Phenyl-1,3-oxathiol-2-ylidene)piperidin-1-ium perchlorate |
|---|---|
| PubChem CID | 85781811 |
| Molecular Formula | C14H16ClNO5S |
| Molecular Weight | 345.80 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | 1-(5-phenyl-1,3-oxathiol-2-ylidene)piperidin-1-ium perchlorate |
| SMILES | C1CC[N+](=C2OC(=CS2)C3=CC=CC=C3)CC1.[O-]Cl(=O)(=O)=O |
| InChI | InChI=1S/C14H16NOS.ClHO4/c1-3-7-12(8-4-1)13-11-17-14(16-13)15-9-5-2-6-10-15;2-1(3,4)5/h1,3-4,7-8,11H,2,5-6,9-10H2;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | QMCCMIWTPCLRTR-UHFFFAOYSA-M |
| XLogP | — |
| TPSA | 112.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | 430 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|