C19H20N2O6S — CID 8578826
[2-[2-(2-methoxyphenyl)ethylamino]-2-oxoethyl] 2-(4-nitrophenyl)sulfanylacetate (PubChem CID 8578826) has the molecular formula C19H20N2O6S and a molecular weight of 404.44 g/mol. Its IUPAC name is [2-[2-(2-methoxyphenyl)ethylamino]-2-oxoethyl] 2-(4-nitrophenyl)sulfanylacetate.
| Compound Name | [2-[2-(2-methoxyphenyl)ethylamino]-2-oxoethyl] 2-(4-nitrophenyl)sulfanylacetate |
|---|---|
| PubChem CID | 8578826 |
| Molecular Formula | C19H20N2O6S |
| Molecular Weight | 404.44 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | [2-[2-(2-methoxyphenyl)ethylamino]-2-oxoethyl] 2-(4-nitrophenyl)sulfanylacetate |
| SMILES | COc1ccccc1CCNC(=O)COC(=O)CSc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H20N2O6S/c1-26-17-5-3-2-4-14(17)10-11-20-18(22)12-27-19(23)13-28-16-8-6-15(7-9-16)21(24)25/h2-9H,10-13H2,1H3,(H,20,22) |
| InChIKey | SEEHXOUKDZGQBB-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.44 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|