About 3-O-tert-butyl 1-O-methyl 2-diazopropanedioate
3-O-tert-butyl 1-O-methyl 2-diazopropanedioate (PubChem CID 85816872) has the molecular formula C8H12N2O4
and a molecular weight of 200.19 g/mol. Its IUPAC name is 3-O-tert-butyl 1-O-methyl 2-diazopropanedioate.
Molecular Properties
| Compound Name | 3-O-tert-butyl 1-O-methyl 2-diazopropanedioate |
| PubChem CID | 85816872 |
| Molecular Formula | C8H12N2O4 |
| Molecular Weight | 200.19 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | 3-O-tert-butyl 1-O-methyl 2-diazopropanedioate |
| SMILES | CC(C)(C)OC(=O)C(=[N+]=[N-])C(=O)OC |
| InChI | InChI=1S/C8H12N2O4/c1-8(2,3)14-7(12)5(10-9)6(11)13-4/h1-4H3 |
| InChIKey | LNYWNGMUAGRMPG-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 54.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | 297 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.19 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 3-O-tert-butyl 1-O-methyl 2-diazopropanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-O-tert-butyl 1-O-methyl 2-diazopropanedioate?
The IUPAC name of 3-O-tert-butyl 1-O-methyl 2-diazopropanedioate (CID 85816872) is 3-O-tert-butyl 1-O-methyl 2-diazopropanedioate.
What is the SMILES notation for 3-O-tert-butyl 1-O-methyl 2-diazopropanedioate?
The canonical SMILES for 3-O-tert-butyl 1-O-methyl 2-diazopropanedioate is CC(C)(C)OC(=O)C(=[N+]=[N-])C(=O)OC.
What is the InChIKey of 3-O-tert-butyl 1-O-methyl 2-diazopropanedioate?
The InChIKey is LNYWNGMUAGRMPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O4/c1-8(2,3)14-7(12)5(10-9)6(11)13-4/h1-4H3.
What are the key properties of 3-O-tert-butyl 1-O-methyl 2-diazopropanedioate?
3-O-tert-butyl 1-O-methyl 2-diazopropanedioate has a molecular weight of 200.19 g/mol, XLogP of 1.60, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-O-tert-butyl 1-O-methyl 2-diazopropanedioate is sourced from PubChem (CID 85816872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).