C15H13FN2O3 — CID 858196
1-(1,3-benzodioxol-5-ylmethyl)-3-(4-fluorophenyl)urea (PubChem CID 858196) has the molecular formula C15H13FN2O3 and a molecular weight of 288.28 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-3-(4-fluorophenyl)urea.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-(4-fluorophenyl)urea |
|---|---|
| PubChem CID | 858196 |
| Molecular Formula | C15H13FN2O3 |
| Molecular Weight | 288.28 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-(4-fluorophenyl)urea |
| SMILES | O=C(NCc1ccc2c(c1)OCO2)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C15H13FN2O3/c16-11-2-4-12(5-3-11)18-15(19)17-8-10-1-6-13-14(7-10)21-9-20-13/h1-7H,8-9H2,(H2,17,18,19) |
| InChIKey | OVDFVDLGCJKWCF-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.28 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |