C22H30N3O3S+ — CID 8583036
2-[(2S)-2-methylpiperidin-1-ium-1-yl]-1-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)ethanone (PubChem CID 8583036) has the molecular formula C22H30N3O3S+ and a molecular weight of 416.57 g/mol. Its IUPAC name is 2-[(2S)-2-methylpiperidin-1-ium-1-yl]-1-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)ethanone.
| Compound Name | 2-[(2S)-2-methylpiperidin-1-ium-1-yl]-1-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 8583036 |
| Molecular Formula | C22H30N3O3S+ |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | 2-[(2S)-2-methylpiperidin-1-ium-1-yl]-1-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)ethanone |
| SMILES | C[C@H]1CCCC[NH+]1CC(=O)N1CCN(S(=O)(=O)c2ccc3ccccc3c2)CC1 |
| InChI | InChI=1S/C22H29N3O3S/c1-18-6-4-5-11-24(18)17-22(26)23-12-14-25(15-13-23)29(27,28)21-10-9-19-7-2-3-8-20(19)16-21/h2-3,7-10,16,18H,4-6,11-15,17H2,1H3/p+1/t18-/m0/s1 |
| InChIKey | KEDCOBLAHOOKIM-SFHVURJKSA-O |
| XLogP | 1.13 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |