C21H24NO2+ — CID 8583520
1-(azocan-1-ium-1-ylmethyl)benzo[f]chromen-3-one (PubChem CID 8583520) has the molecular formula C21H24NO2+ and a molecular weight of 322.43 g/mol. Its IUPAC name is 1-(azocan-1-ium-1-ylmethyl)benzo[f]chromen-3-one.
| Compound Name | 1-(azocan-1-ium-1-ylmethyl)benzo[f]chromen-3-one |
|---|---|
| PubChem CID | 8583520 |
| Molecular Formula | C21H24NO2+ |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | 1-(azocan-1-ium-1-ylmethyl)benzo[f]chromen-3-one |
| SMILES | O=c1cc(C[NH+]2CCCCCCC2)c2c(ccc3ccccc32)o1 |
| InChI | InChI=1S/C21H23NO2/c23-20-14-17(15-22-12-6-2-1-3-7-13-22)21-18-9-5-4-8-16(18)10-11-19(21)24-20/h4-5,8-11,14H,1-3,6-7,12-13,15H2/p+1 |
| InChIKey | LJEGUFFJDKPSER-UHFFFAOYSA-O |
| XLogP | 3.30 |
| TPSA | 34.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|