C15H17F5N2O — CID 8583785
2-(azocan-1-yl)-N-(2,3,4,5,6-pentafluorophenyl)acetamide (PubChem CID 8583785) has the molecular formula C15H17F5N2O and a molecular weight of 336.30 g/mol. Its IUPAC name is 2-(azocan-1-yl)-N-(2,3,4,5,6-pentafluorophenyl)acetamide.
| Compound Name | 2-(azocan-1-yl)-N-(2,3,4,5,6-pentafluorophenyl)acetamide |
|---|---|
| PubChem CID | 8583785 |
| Molecular Formula | C15H17F5N2O |
| Molecular Weight | 336.30 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | 2-(azocan-1-yl)-N-(2,3,4,5,6-pentafluorophenyl)acetamide |
| SMILES | O=C(CN1CCCCCCC1)Nc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C15H17F5N2O/c16-10-11(17)13(19)15(14(20)12(10)18)21-9(23)8-22-6-4-2-1-3-5-7-22/h1-8H2,(H,21,23) |
| InChIKey | LHPQXDVRPSNONA-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.30 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|