C19H20F2N3OS+ — CID 8585959
[(1R)-1-(2,4-difluorophenyl)ethyl]-[(4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)methyl]azanium (PubChem CID 8585959) has the molecular formula C19H20F2N3OS+ and a molecular weight of 376.45 g/mol. Its IUPAC name is [(1R)-1-(2,4-difluorophenyl)ethyl]-[(4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)methyl]azanium.
| Compound Name | [(1R)-1-(2,4-difluorophenyl)ethyl]-[(4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)methyl]azanium |
|---|---|
| PubChem CID | 8585959 |
| Molecular Formula | C19H20F2N3OS+ |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | [(1R)-1-(2,4-difluorophenyl)ethyl]-[(4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)methyl]azanium |
| SMILES | C[C@@H]([NH2+]Cc1nc2sc3c(c2c(=O)[nH]1)CCCC3)c1ccc(F)cc1F |
| InChI | InChI=1S/C19H19F2N3OS/c1-10(12-7-6-11(20)8-14(12)21)22-9-16-23-18(25)17-13-4-2-3-5-15(13)26-19(17)24-16/h6-8,10,22H,2-5,9H2,1H3,(H,23,24,25)/p+1/t10-/m1/s1 |
| InChIKey | AIAXSHWXJMGBAL-SNVBAGLBSA-O |
| XLogP | 2.97 |
| TPSA | 62.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |