C21H33N3O4S — CID 8587184
N-[(2S)-butan-2-yl]-N-[(3S)-1,1-dioxothiolan-3-yl]-2-[4-(4-methoxyphenyl)piperazin-1-yl]acetamide (PubChem CID 8587184) has the molecular formula C21H33N3O4S and a molecular weight of 423.58 g/mol. Its IUPAC name is N-[(2S)-butan-2-yl]-N-[(3S)-1,1-dioxothiolan-3-yl]-2-[4-(4-methoxyphenyl)piperazin-1-yl]acetamide.
| Compound Name | N-[(2S)-butan-2-yl]-N-[(3S)-1,1-dioxothiolan-3-yl]-2-[4-(4-methoxyphenyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 8587184 |
| Molecular Formula | C21H33N3O4S |
| Molecular Weight | 423.58 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | N-[(2S)-butan-2-yl]-N-[(3S)-1,1-dioxothiolan-3-yl]-2-[4-(4-methoxyphenyl)piperazin-1-yl]acetamide |
| SMILES | CC[C@H](C)N(C(=O)CN1CCN(c2ccc(OC)cc2)CC1)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C21H33N3O4S/c1-4-17(2)24(19-9-14-29(26,27)16-19)21(25)15-22-10-12-23(13-11-22)18-5-7-20(28-3)8-6-18/h5-8,17,19H,4,9-16H2,1-3H3/t17-,19-/m0/s1 |
| InChIKey | WUNUAEONTOOUHL-HKUYNNGSSA-N |
| XLogP | 1.63 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.58 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|