C23H29N3O2S — CID 8587483
2-[4-(4-methoxyphenyl)piperazin-1-yl]-1-[(2S)-2-methyl-3,4-dihydro-2H-1,5-benzothiazepin-5-yl]ethanone (PubChem CID 8587483) has the molecular formula C23H29N3O2S and a molecular weight of 411.57 g/mol. Its IUPAC name is 2-[4-(4-methoxyphenyl)piperazin-1-yl]-1-[(2S)-2-methyl-3,4-dihydro-2H-1,5-benzothiazepin-5-yl]ethanone.
| Compound Name | 2-[4-(4-methoxyphenyl)piperazin-1-yl]-1-[(2S)-2-methyl-3,4-dihydro-2H-1,5-benzothiazepin-5-yl]ethanone |
|---|---|
| PubChem CID | 8587483 |
| Molecular Formula | C23H29N3O2S |
| Molecular Weight | 411.57 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | 2-[4-(4-methoxyphenyl)piperazin-1-yl]-1-[(2S)-2-methyl-3,4-dihydro-2H-1,5-benzothiazepin-5-yl]ethanone |
| SMILES | COc1ccc(N2CCN(CC(=O)N3CC[C@H](C)Sc4ccccc43)CC2)cc1 |
| InChI | InChI=1S/C23H29N3O2S/c1-18-11-12-26(21-5-3-4-6-22(21)29-18)23(27)17-24-13-15-25(16-14-24)19-7-9-20(28-2)10-8-19/h3-10,18H,11-17H2,1-2H3/t18-/m0/s1 |
| InChIKey | UJLMQDJEOKZGBW-SFHVURJKSA-N |
| XLogP | 3.73 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.57 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|