C25H24N2O4 — CID 8589068
naphthalen-1-ylmethyl 2-[(4S)-4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]acetate (PubChem CID 8589068) has the molecular formula C25H24N2O4 and a molecular weight of 416.48 g/mol. Its IUPAC name is naphthalen-1-ylmethyl 2-[(4S)-4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]acetate.
| Compound Name | naphthalen-1-ylmethyl 2-[(4S)-4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]acetate |
|---|---|
| PubChem CID | 8589068 |
| Molecular Formula | C25H24N2O4 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | naphthalen-1-ylmethyl 2-[(4S)-4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]acetate |
| SMILES | C[C@@]1(CCc2ccccc2)NC(=O)N(CC(=O)OCc2cccc3ccccc23)C1=O |
| InChI | InChI=1S/C25H24N2O4/c1-25(15-14-18-8-3-2-4-9-18)23(29)27(24(30)26-25)16-22(28)31-17-20-12-7-11-19-10-5-6-13-21(19)20/h2-13H,14-17H2,1H3,(H,26,30)/t25-/m0/s1 |
| InChIKey | ZCLVRJGIVQXIKD-VWLOTQADSA-N |
| XLogP | 3.83 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|