C21H19FN2O3 — CID 8589442
7-fluoro-3-methyl-N-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]-1-benzofuran-2-carboxamide (PubChem CID 8589442) has the molecular formula C21H19FN2O3 and a molecular weight of 366.39 g/mol. Its IUPAC name is 7-fluoro-3-methyl-N-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]-1-benzofuran-2-carboxamide.
| Compound Name | 7-fluoro-3-methyl-N-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 8589442 |
| Molecular Formula | C21H19FN2O3 |
| Molecular Weight | 366.39 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | 7-fluoro-3-methyl-N-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]-1-benzofuran-2-carboxamide |
| SMILES | Cc1c(C(=O)NCc2ccc(N3CCCC3=O)cc2)oc2c(F)cccc12 |
| InChI | InChI=1S/C21H19FN2O3/c1-13-16-4-2-5-17(22)20(16)27-19(13)21(26)23-12-14-7-9-15(10-8-14)24-11-3-6-18(24)25/h2,4-5,7-10H,3,6,11-12H2,1H3,(H,23,26) |
| InChIKey | HMAPAVJHVVWQER-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.39 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |