C17H14Cl2FNO3 — CID 8589753
[(2S)-1-(2,4-dichloroanilino)-1-oxopropan-2-yl] 2-(3-fluorophenyl)acetate (PubChem CID 8589753) has the molecular formula C17H14Cl2FNO3 and a molecular weight of 370.21 g/mol. Its IUPAC name is [(2S)-1-(2,4-dichloroanilino)-1-oxopropan-2-yl] 2-(3-fluorophenyl)acetate.
| Compound Name | [(2S)-1-(2,4-dichloroanilino)-1-oxopropan-2-yl] 2-(3-fluorophenyl)acetate |
|---|---|
| PubChem CID | 8589753 |
| Molecular Formula | C17H14Cl2FNO3 |
| Molecular Weight | 370.21 g/mol |
| Exact Mass | 369.03 |
| IUPAC Name | [(2S)-1-(2,4-dichloroanilino)-1-oxopropan-2-yl] 2-(3-fluorophenyl)acetate |
| SMILES | C[C@H](OC(=O)Cc1cccc(F)c1)C(=O)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H14Cl2FNO3/c1-10(17(23)21-15-6-5-12(18)9-14(15)19)24-16(22)8-11-3-2-4-13(20)7-11/h2-7,9-10H,8H2,1H3,(H,21,23)/t10-/m0/s1 |
| InChIKey | DZFIHBFKOBUQBS-JTQLQIEISA-N |
| XLogP | 4.25 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.21 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |