C16H14N6O3 — CID 859093
2-[5-(2-aminophenyl)tetrazol-2-yl]-N-(1,3-benzodioxol-5-yl)acetamide (PubChem CID 859093) has the molecular formula C16H14N6O3 and a molecular weight of 338.33 g/mol. Its IUPAC name is 2-[5-(2-aminophenyl)tetrazol-2-yl]-N-(1,3-benzodioxol-5-yl)acetamide.
| Compound Name | 2-[5-(2-aminophenyl)tetrazol-2-yl]-N-(1,3-benzodioxol-5-yl)acetamide |
|---|---|
| PubChem CID | 859093 |
| Molecular Formula | C16H14N6O3 |
| Molecular Weight | 338.33 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | 2-[5-(2-aminophenyl)tetrazol-2-yl]-N-(1,3-benzodioxol-5-yl)acetamide |
| SMILES | Nc1ccccc1-c1nnn(CC(=O)Nc2ccc3c(c2)OCO3)n1 |
| InChI | InChI=1S/C16H14N6O3/c17-12-4-2-1-3-11(12)16-19-21-22(20-16)8-15(23)18-10-5-6-13-14(7-10)25-9-24-13/h1-7H,8-9,17H2,(H,18,23) |
| InChIKey | MCESMSKLTOOTKG-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 117.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.33 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|