About magnesium bis(2-acetyloxybenzoate)
magnesium bis(2-acetyloxybenzoate) (PubChem CID 8591) has the molecular formula C18H14MgO8
and a molecular weight of 382.61 g/mol. Its IUPAC name is magnesium bis(2-acetyloxybenzoate).
Molecular Properties
| Compound Name | magnesium bis(2-acetyloxybenzoate) |
| PubChem CID | 8591 |
| Molecular Formula | C18H14MgO8 |
| Molecular Weight | 382.61 g/mol |
| Exact Mass | 382.05 |
| IUPAC Name | magnesium bis(2-acetyloxybenzoate) |
| SMILES | CC(=O)Oc1ccccc1C(=O)[O-].CC(=O)Oc1ccccc1C(=O)[O-].[Mg+2] |
| InChI | InChI=1S/2C9H8O4.Mg/c2*1-6(10)13-8-5-3-2-4-7(8)9(11)12;/h2*2-5H,1H3,(H,11,12);/q;;+2/p-2 |
| InChIKey | RBLKLJDYAHZCFW-UHFFFAOYSA-L |
| XLogP | -0.43 |
| TPSA | 132.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.61 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze magnesium bis(2-acetyloxybenzoate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium bis(2-acetyloxybenzoate)?
The IUPAC name of magnesium bis(2-acetyloxybenzoate) (CID 8591) is magnesium bis(2-acetyloxybenzoate).
What is the SMILES notation for magnesium bis(2-acetyloxybenzoate)?
The canonical SMILES for magnesium bis(2-acetyloxybenzoate) is CC(=O)Oc1ccccc1C(=O)[O-].CC(=O)Oc1ccccc1C(=O)[O-].[Mg+2].
What is the InChIKey of magnesium bis(2-acetyloxybenzoate)?
The InChIKey is RBLKLJDYAHZCFW-UHFFFAOYSA-L. The full InChI is InChI=1S/2C9H8O4.Mg/c2*1-6(10)13-8-5-3-2-4-7(8)9(11)12;/h2*2-5H,1H3,(H,11,12);/q;;+2/p-2.
What are the key properties of magnesium bis(2-acetyloxybenzoate)?
magnesium bis(2-acetyloxybenzoate) has a molecular weight of 382.61 g/mol, XLogP of -0.43, 4 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium bis(2-acetyloxybenzoate) is sourced from PubChem (CID 8591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).