C19H23ClN2O3 — CID 8591071
methyl 5-[[4-(5-chloro-2-methylphenyl)piperazin-1-yl]methyl]-2-methylfuran-3-carboxylate (PubChem CID 8591071) has the molecular formula C19H23ClN2O3 and a molecular weight of 362.86 g/mol. Its IUPAC name is methyl 5-[[4-(5-chloro-2-methylphenyl)piperazin-1-yl]methyl]-2-methylfuran-3-carboxylate.
| Compound Name | methyl 5-[[4-(5-chloro-2-methylphenyl)piperazin-1-yl]methyl]-2-methylfuran-3-carboxylate |
|---|---|
| PubChem CID | 8591071 |
| Molecular Formula | C19H23ClN2O3 |
| Molecular Weight | 362.86 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | methyl 5-[[4-(5-chloro-2-methylphenyl)piperazin-1-yl]methyl]-2-methylfuran-3-carboxylate |
| SMILES | COC(=O)c1cc(CN2CCN(c3cc(Cl)ccc3C)CC2)oc1C |
| InChI | InChI=1S/C19H23ClN2O3/c1-13-4-5-15(20)10-18(13)22-8-6-21(7-9-22)12-16-11-17(14(2)25-16)19(23)24-3/h4-5,10-11H,6-9,12H2,1-3H3 |
| InChIKey | IYPXCNOMJJRDEJ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 45.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.86 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |