C22H27ClN3O2+ — CID 8591576
2-[4-(4-acetylphenyl)piperazin-1-ium-1-yl]-N-[(1S)-1-(2-chlorophenyl)ethyl]acetamide (PubChem CID 8591576) has the molecular formula C22H27ClN3O2+ and a molecular weight of 400.93 g/mol. Its IUPAC name is 2-[4-(4-acetylphenyl)piperazin-1-ium-1-yl]-N-[(1S)-1-(2-chlorophenyl)ethyl]acetamide.
| Compound Name | 2-[4-(4-acetylphenyl)piperazin-1-ium-1-yl]-N-[(1S)-1-(2-chlorophenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 8591576 |
| Molecular Formula | C22H27ClN3O2+ |
| Molecular Weight | 400.93 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | 2-[4-(4-acetylphenyl)piperazin-1-ium-1-yl]-N-[(1S)-1-(2-chlorophenyl)ethyl]acetamide |
| SMILES | CC(=O)c1ccc(N2CC[NH+](CC(=O)N[C@@H](C)c3ccccc3Cl)CC2)cc1 |
| InChI | InChI=1S/C22H26ClN3O2/c1-16(20-5-3-4-6-21(20)23)24-22(28)15-25-11-13-26(14-12-25)19-9-7-18(8-10-19)17(2)27/h3-10,16H,11-15H2,1-2H3,(H,24,28)/p+1/t16-/m0/s1 |
| InChIKey | CSGMVQONCXDLON-INIZCTEOSA-O |
| XLogP | 2.12 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.93 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |