C17H15N3OS — CID 8591940
N-(3-cyanophenyl)-2-(2,3-dihydro-1,4-benzothiazin-4-yl)acetamide (PubChem CID 8591940) has the molecular formula C17H15N3OS and a molecular weight of 309.39 g/mol. Its IUPAC name is N-(3-cyanophenyl)-2-(2,3-dihydro-1,4-benzothiazin-4-yl)acetamide.
| Compound Name | N-(3-cyanophenyl)-2-(2,3-dihydro-1,4-benzothiazin-4-yl)acetamide |
|---|---|
| PubChem CID | 8591940 |
| Molecular Formula | C17H15N3OS |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | N-(3-cyanophenyl)-2-(2,3-dihydro-1,4-benzothiazin-4-yl)acetamide |
| SMILES | N#Cc1cccc(NC(=O)CN2CCSc3ccccc32)c1 |
| InChI | InChI=1S/C17H15N3OS/c18-11-13-4-3-5-14(10-13)19-17(21)12-20-8-9-22-16-7-2-1-6-15(16)20/h1-7,10H,8-9,12H2,(H,19,21) |
| InChIKey | WPIYRWLFXKRVHR-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |