C19H20BrN3O2 — CID 8593408
2-bromo-N'-[2-(6-methyl-3,4-dihydro-2H-quinolin-1-yl)acetyl]benzohydrazide (PubChem CID 8593408) has the molecular formula C19H20BrN3O2 and a molecular weight of 402.29 g/mol. Its IUPAC name is 2-bromo-N'-[2-(6-methyl-3,4-dihydro-2H-quinolin-1-yl)acetyl]benzohydrazide.
| Compound Name | 2-bromo-N'-[2-(6-methyl-3,4-dihydro-2H-quinolin-1-yl)acetyl]benzohydrazide |
|---|---|
| PubChem CID | 8593408 |
| Molecular Formula | C19H20BrN3O2 |
| Molecular Weight | 402.29 g/mol |
| Exact Mass | 401.07 |
| IUPAC Name | 2-bromo-N'-[2-(6-methyl-3,4-dihydro-2H-quinolin-1-yl)acetyl]benzohydrazide |
| SMILES | Cc1ccc2c(c1)CCCN2CC(=O)NNC(=O)c1ccccc1Br |
| InChI | InChI=1S/C19H20BrN3O2/c1-13-8-9-17-14(11-13)5-4-10-23(17)12-18(24)21-22-19(25)15-6-2-3-7-16(15)20/h2-3,6-9,11H,4-5,10,12H2,1H3,(H,21,24)(H,22,25) |
| InChIKey | GYHGWDMCRLIDOF-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.29 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|