About 2-[(7-methyl-[1,3]dioxolo[4,5-g]quinolin-6-yl)sulfanyl]-1-morpholin-4-ylethanone
2-[(7-methyl-[1,3]dioxolo[4,5-g]quinolin-6-yl)sulfanyl]-1-morpholin-4-ylethanone (PubChem CID 859517) has the molecular formula C17H18N2O4S
and a molecular weight of 346.41 g/mol. Its IUPAC name is 2-[(7-methyl-[1,3]dioxolo[4,5-g]quinolin-6-yl)sulfanyl]-1-morpholin-4-ylethanone.
Molecular Properties
| Compound Name | 2-[(7-methyl-[1,3]dioxolo[4,5-g]quinolin-6-yl)sulfanyl]-1-morpholin-4-ylethanone |
| PubChem CID | 859517 |
| Molecular Formula | C17H18N2O4S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 2-[(7-methyl-[1,3]dioxolo[4,5-g]quinolin-6-yl)sulfanyl]-1-morpholin-4-ylethanone |
| SMILES | Cc1cc2cc3c(cc2nc1SCC(=O)N1CCOCC1)OCO3 |
| InChI | InChI=1S/C17H18N2O4S/c1-11-6-12-7-14-15(23-10-22-14)8-13(12)18-17(11)24-9-16(20)19-2-4-21-5-3-19/h6-8H,2-5,9-10H2,1H3 |
| InChIKey | BLWMANZCZCCMAS-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[(7-methyl-[1,3]dioxolo[4,5-g]quinolin-6-yl)sulfanyl]-1-morpholin-4-ylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(7-methyl-[1,3]dioxolo[4,5-g]quinolin-6-yl)sulfanyl]-1-morpholin-4-ylethanone?
The IUPAC name of 2-[(7-methyl-[1,3]dioxolo[4,5-g]quinolin-6-yl)sulfanyl]-1-morpholin-4-ylethanone (CID 859517) is 2-[(7-methyl-[1,3]dioxolo[4,5-g]quinolin-6-yl)sulfanyl]-1-morpholin-4-ylethanone.
What is the SMILES notation for 2-[(7-methyl-[1,3]dioxolo[4,5-g]quinolin-6-yl)sulfanyl]-1-morpholin-4-ylethanone?
The canonical SMILES for 2-[(7-methyl-[1,3]dioxolo[4,5-g]quinolin-6-yl)sulfanyl]-1-morpholin-4-ylethanone is Cc1cc2cc3c(cc2nc1SCC(=O)N1CCOCC1)OCO3.
What is the InChIKey of 2-[(7-methyl-[1,3]dioxolo[4,5-g]quinolin-6-yl)sulfanyl]-1-morpholin-4-ylethanone?
The InChIKey is BLWMANZCZCCMAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18N2O4S/c1-11-6-12-7-14-15(23-10-22-14)8-13(12)18-17(11)24-9-16(20)19-2-4-21-5-3-19/h6-8H,2-5,9-10H2,1H3.
What are the key properties of 2-[(7-methyl-[1,3]dioxolo[4,5-g]quinolin-6-yl)sulfanyl]-1-morpholin-4-ylethanone?
2-[(7-methyl-[1,3]dioxolo[4,5-g]quinolin-6-yl)sulfanyl]-1-morpholin-4-ylethanone has a molecular weight of 346.41 g/mol, XLogP of 2.22, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(7-methyl-[1,3]dioxolo[4,5-g]quinolin-6-yl)sulfanyl]-1-morpholin-4-ylethanone is sourced from PubChem (CID 859517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).