About Acethylethylenimine
Acethylethylenimine (PubChem CID 85965243) has the molecular formula C4H5NO
and a molecular weight of 83.09 g/mol. Its IUPAC name is 1-(2H-azirin-2-yl)ethanone.
Molecular Properties
| Compound Name | Acethylethylenimine |
| PubChem CID | 85965243 |
| Molecular Formula | C4H5NO |
| Molecular Weight | 83.09 g/mol |
| Exact Mass | 83.04 |
| IUPAC Name | 1-(2H-azirin-2-yl)ethanone |
| SMILES | CC(=O)C1C=N1 |
| InChI | InChI=1S/C4H5NO/c1-3(6)4-2-5-4/h2,4H,1H3 |
| InChIKey | LXSQUKZTZXNNCC-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 29.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | 106 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 83.09 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze Acethylethylenimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Acethylethylenimine?
The IUPAC name of Acethylethylenimine (CID 85965243) is 1-(2H-azirin-2-yl)ethanone.
What is the SMILES notation for Acethylethylenimine?
The canonical SMILES for Acethylethylenimine is CC(=O)C1C=N1.
What is the InChIKey of Acethylethylenimine?
The InChIKey is LXSQUKZTZXNNCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5NO/c1-3(6)4-2-5-4/h2,4H,1H3.
What are the key properties of Acethylethylenimine?
Acethylethylenimine has a molecular weight of 83.09 g/mol, XLogP of -0.40, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for Acethylethylenimine is sourced from PubChem (CID 85965243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).