About (1R,4S)-7,7-dimethyl-1-(morpholin-4-ylsulfonylmethyl)bicyclo[2.2.1]heptan-2-one
(1R,4S)-7,7-dimethyl-1-(morpholin-4-ylsulfonylmethyl)bicyclo[2.2.1]heptan-2-one (PubChem CID 859958) has the molecular formula C14H23NO4S
and a molecular weight of 301.41 g/mol. Its IUPAC name is (1R,4S)-7,7-dimethyl-1-(morpholin-4-ylsulfonylmethyl)bicyclo[2.2.1]heptan-2-one.
Molecular Properties
| Compound Name | (1R,4S)-7,7-dimethyl-1-(morpholin-4-ylsulfonylmethyl)bicyclo[2.2.1]heptan-2-one |
| PubChem CID | 859958 |
| Molecular Formula | C14H23NO4S |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | (1R,4S)-7,7-dimethyl-1-(morpholin-4-ylsulfonylmethyl)bicyclo[2.2.1]heptan-2-one |
| SMILES | CC1(C)[C@H]2CC[C@]1(CS(=O)(=O)N1CCOCC1)C(=O)C2 |
| InChI | InChI=1S/C14H23NO4S/c1-13(2)11-3-4-14(13,12(16)9-11)10-20(17,18)15-5-7-19-8-6-15/h11H,3-10H2,1-2H3/t11-,14-/m0/s1 |
| InChIKey | UFVYTBAYGAJUQD-FZMZJTMJSA-N |
| XLogP | 1.04 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (1R,4S)-7,7-dimethyl-1-(morpholin-4-ylsulfonylmethyl)bicyclo[2.2.1]heptan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,4S)-7,7-dimethyl-1-(morpholin-4-ylsulfonylmethyl)bicyclo[2.2.1]heptan-2-one?
The IUPAC name of (1R,4S)-7,7-dimethyl-1-(morpholin-4-ylsulfonylmethyl)bicyclo[2.2.1]heptan-2-one (CID 859958) is (1R,4S)-7,7-dimethyl-1-(morpholin-4-ylsulfonylmethyl)bicyclo[2.2.1]heptan-2-one.
What is the SMILES notation for (1R,4S)-7,7-dimethyl-1-(morpholin-4-ylsulfonylmethyl)bicyclo[2.2.1]heptan-2-one?
The canonical SMILES for (1R,4S)-7,7-dimethyl-1-(morpholin-4-ylsulfonylmethyl)bicyclo[2.2.1]heptan-2-one is CC1(C)[C@H]2CC[C@]1(CS(=O)(=O)N1CCOCC1)C(=O)C2.
What is the InChIKey of (1R,4S)-7,7-dimethyl-1-(morpholin-4-ylsulfonylmethyl)bicyclo[2.2.1]heptan-2-one?
The InChIKey is UFVYTBAYGAJUQD-FZMZJTMJSA-N. The full InChI is InChI=1S/C14H23NO4S/c1-13(2)11-3-4-14(13,12(16)9-11)10-20(17,18)15-5-7-19-8-6-15/h11H,3-10H2,1-2H3/t11-,14-/m0/s1.
What are the key properties of (1R,4S)-7,7-dimethyl-1-(morpholin-4-ylsulfonylmethyl)bicyclo[2.2.1]heptan-2-one?
(1R,4S)-7,7-dimethyl-1-(morpholin-4-ylsulfonylmethyl)bicyclo[2.2.1]heptan-2-one has a molecular weight of 301.41 g/mol, XLogP of 1.04, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,4S)-7,7-dimethyl-1-(morpholin-4-ylsulfonylmethyl)bicyclo[2.2.1]heptan-2-one is sourced from PubChem (CID 859958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).