About pentacyclo[9.5.1.13,9.15,15.17,13]icosane
pentacyclo[9.5.1.13,9.15,15.17,13]icosane (PubChem CID 86001136) has the molecular formula C20H32
and a molecular weight of 272.48 g/mol. Its IUPAC name is pentacyclo[9.5.1.13,9.15,15.17,13]icosane.
Molecular Properties
| Compound Name | pentacyclo[9.5.1.13,9.15,15.17,13]icosane |
| PubChem CID | 86001136 |
| Molecular Formula | C20H32 |
| Molecular Weight | 272.48 g/mol |
| Exact Mass | 272.25 |
| IUPAC Name | pentacyclo[9.5.1.13,9.15,15.17,13]icosane |
| SMILES | C1C2CC3CC4CC1CC1CC(C2)CC(C3)CC(C4)C1 |
| InChI | InChI=1S/C20H32/c1-13-2-15-6-17-4-14(1)5-18-7-16(3-13)9-19(8-15)12-20(10-17)11-18/h13-20H,1-12H2 |
| InChIKey | LFUSVBWBXRDDCM-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 272.48 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze pentacyclo[9.5.1.13,9.15,15.17,13]icosane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentacyclo[9.5.1.13,9.15,15.17,13]icosane?
The IUPAC name of pentacyclo[9.5.1.13,9.15,15.17,13]icosane (CID 86001136) is pentacyclo[9.5.1.13,9.15,15.17,13]icosane.
What is the SMILES notation for pentacyclo[9.5.1.13,9.15,15.17,13]icosane?
The canonical SMILES for pentacyclo[9.5.1.13,9.15,15.17,13]icosane is C1C2CC3CC4CC1CC1CC(C2)CC(C3)CC(C4)C1.
What is the InChIKey of pentacyclo[9.5.1.13,9.15,15.17,13]icosane?
The InChIKey is LFUSVBWBXRDDCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H32/c1-13-2-15-6-17-4-14(1)5-18-7-16(3-13)9-19(8-15)12-20(10-17)11-18/h13-20H,1-12H2.
What are the key properties of pentacyclo[9.5.1.13,9.15,15.17,13]icosane?
pentacyclo[9.5.1.13,9.15,15.17,13]icosane has a molecular weight of 272.48 g/mol, XLogP of 5.67, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for pentacyclo[9.5.1.13,9.15,15.17,13]icosane is sourced from PubChem (CID 86001136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).