About 8-bromo-2-chloroindolo[2,1-b]quinazoline-6,12-dione
8-bromo-2-chloroindolo[2,1-b]quinazoline-6,12-dione (PubChem CID 86003970) has the molecular formula C15H6BrClN2O2
and a molecular weight of 361.58 g/mol. Its IUPAC name is 8-bromo-2-chloroindolo[2,1-b]quinazoline-6,12-dione.
Molecular Properties
| Compound Name | 8-bromo-2-chloroindolo[2,1-b]quinazoline-6,12-dione |
| PubChem CID | 86003970 |
| Molecular Formula | C15H6BrClN2O2 |
| Molecular Weight | 361.58 g/mol |
| Exact Mass | 359.93 |
| IUPAC Name | 8-bromo-2-chloroindolo[2,1-b]quinazoline-6,12-dione |
| SMILES | O=C1c2cc(Br)ccc2-n2c1nc1ccc(Cl)cc1c2=O |
| InChI | InChI=1S/C15H6BrClN2O2/c16-7-1-4-12-10(5-7)13(20)14-18-11-3-2-8(17)6-9(11)15(21)19(12)14/h1-6H |
| InChIKey | HJETZUOXLCYVPZ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.58 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-bromo-2-chloroindolo[2,1-b]quinazoline-6,12-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-bromo-2-chloroindolo[2,1-b]quinazoline-6,12-dione?
The IUPAC name of 8-bromo-2-chloroindolo[2,1-b]quinazoline-6,12-dione (CID 86003970) is 8-bromo-2-chloroindolo[2,1-b]quinazoline-6,12-dione.
What is the SMILES notation for 8-bromo-2-chloroindolo[2,1-b]quinazoline-6,12-dione?
The canonical SMILES for 8-bromo-2-chloroindolo[2,1-b]quinazoline-6,12-dione is O=C1c2cc(Br)ccc2-n2c1nc1ccc(Cl)cc1c2=O.
What is the InChIKey of 8-bromo-2-chloroindolo[2,1-b]quinazoline-6,12-dione?
The InChIKey is HJETZUOXLCYVPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H6BrClN2O2/c16-7-1-4-12-10(5-7)13(20)14-18-11-3-2-8(17)6-9(11)15(21)19(12)14/h1-6H.
What are the key properties of 8-bromo-2-chloroindolo[2,1-b]quinazoline-6,12-dione?
8-bromo-2-chloroindolo[2,1-b]quinazoline-6,12-dione has a molecular weight of 361.58 g/mol, XLogP of 3.35, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-bromo-2-chloroindolo[2,1-b]quinazoline-6,12-dione is sourced from PubChem (CID 86003970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).