About 2-(4-ethenylphenyl)-4,6-dithiophen-2-yl-1,3,5-triazine
2-(4-ethenylphenyl)-4,6-dithiophen-2-yl-1,3,5-triazine (PubChem CID 86005531) has the molecular formula C19H13N3S2
and a molecular weight of 347.47 g/mol. Its IUPAC name is 2-(4-ethenylphenyl)-4,6-dithiophen-2-yl-1,3,5-triazine.
Molecular Properties
| Compound Name | 2-(4-ethenylphenyl)-4,6-dithiophen-2-yl-1,3,5-triazine |
| PubChem CID | 86005531 |
| Molecular Formula | C19H13N3S2 |
| Molecular Weight | 347.47 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | 2-(4-ethenylphenyl)-4,6-dithiophen-2-yl-1,3,5-triazine |
| SMILES | C=Cc1ccc(-c2nc(-c3cccs3)nc(-c3cccs3)n2)cc1 |
| InChI | InChI=1S/C19H13N3S2/c1-2-13-7-9-14(10-8-13)17-20-18(15-5-3-11-23-15)22-19(21-17)16-6-4-12-24-16/h2-12H,1H2 |
| InChIKey | YNDHFARPTRCPND-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 347.47 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(4-ethenylphenyl)-4,6-dithiophen-2-yl-1,3,5-triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-ethenylphenyl)-4,6-dithiophen-2-yl-1,3,5-triazine?
The IUPAC name of 2-(4-ethenylphenyl)-4,6-dithiophen-2-yl-1,3,5-triazine (CID 86005531) is 2-(4-ethenylphenyl)-4,6-dithiophen-2-yl-1,3,5-triazine.
What is the SMILES notation for 2-(4-ethenylphenyl)-4,6-dithiophen-2-yl-1,3,5-triazine?
The canonical SMILES for 2-(4-ethenylphenyl)-4,6-dithiophen-2-yl-1,3,5-triazine is C=Cc1ccc(-c2nc(-c3cccs3)nc(-c3cccs3)n2)cc1.
What is the InChIKey of 2-(4-ethenylphenyl)-4,6-dithiophen-2-yl-1,3,5-triazine?
The InChIKey is YNDHFARPTRCPND-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13N3S2/c1-2-13-7-9-14(10-8-13)17-20-18(15-5-3-11-23-15)22-19(21-17)16-6-4-12-24-16/h2-12H,1H2.
What are the key properties of 2-(4-ethenylphenyl)-4,6-dithiophen-2-yl-1,3,5-triazine?
2-(4-ethenylphenyl)-4,6-dithiophen-2-yl-1,3,5-triazine has a molecular weight of 347.47 g/mol, XLogP of 5.64, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-ethenylphenyl)-4,6-dithiophen-2-yl-1,3,5-triazine is sourced from PubChem (CID 86005531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).