About 2-(2,5-dimethylthiomorpholin-4-yl)ethanol
2-(2,5-dimethylthiomorpholin-4-yl)ethanol (PubChem CID 86005954) has the molecular formula C8H17NOS
and a molecular weight of 175.30 g/mol. Its IUPAC name is 2-(2,5-dimethylthiomorpholin-4-yl)ethanol.
Molecular Properties
| Compound Name | 2-(2,5-dimethylthiomorpholin-4-yl)ethanol |
| PubChem CID | 86005954 |
| Molecular Formula | C8H17NOS |
| Molecular Weight | 175.30 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | 2-(2,5-dimethylthiomorpholin-4-yl)ethanol |
| SMILES | CC1CN(CCO)C(C)CS1 |
| InChI | InChI=1S/C8H17NOS/c1-7-6-11-8(2)5-9(7)3-4-10/h7-8,10H,3-6H2,1-2H3 |
| InChIKey | BLVXMSUXBDEICV-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.30 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2,5-dimethylthiomorpholin-4-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,5-dimethylthiomorpholin-4-yl)ethanol?
The IUPAC name of 2-(2,5-dimethylthiomorpholin-4-yl)ethanol (CID 86005954) is 2-(2,5-dimethylthiomorpholin-4-yl)ethanol.
What is the SMILES notation for 2-(2,5-dimethylthiomorpholin-4-yl)ethanol?
The canonical SMILES for 2-(2,5-dimethylthiomorpholin-4-yl)ethanol is CC1CN(CCO)C(C)CS1.
What is the InChIKey of 2-(2,5-dimethylthiomorpholin-4-yl)ethanol?
The InChIKey is BLVXMSUXBDEICV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NOS/c1-7-6-11-8(2)5-9(7)3-4-10/h7-8,10H,3-6H2,1-2H3.
What are the key properties of 2-(2,5-dimethylthiomorpholin-4-yl)ethanol?
2-(2,5-dimethylthiomorpholin-4-yl)ethanol has a molecular weight of 175.30 g/mol, XLogP of 0.80, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-dimethylthiomorpholin-4-yl)ethanol is sourced from PubChem (CID 86005954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).