About 2-[13-(2-aminoethyl)-1,4,10-trioxa-7,13-diazacyclopentadec-7-yl]ethanamine
2-[13-(2-aminoethyl)-1,4,10-trioxa-7,13-diazacyclopentadec-7-yl]ethanamine (PubChem CID 86006351) has the molecular formula C14H32N4O3
and a molecular weight of 304.44 g/mol. Its IUPAC name is 2-[13-(2-aminoethyl)-1,4,10-trioxa-7,13-diazacyclopentadec-7-yl]ethanamine.
Molecular Properties
| Compound Name | 2-[13-(2-aminoethyl)-1,4,10-trioxa-7,13-diazacyclopentadec-7-yl]ethanamine |
| PubChem CID | 86006351 |
| Molecular Formula | C14H32N4O3 |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.25 |
| IUPAC Name | 2-[13-(2-aminoethyl)-1,4,10-trioxa-7,13-diazacyclopentadec-7-yl]ethanamine |
| SMILES | NCCN1CCOCCOCCN(CCN)CCOCC1 |
| InChI | InChI=1S/C14H32N4O3/c15-1-3-17-5-9-19-10-6-18(4-2-16)8-12-21-14-13-20-11-7-17/h1-16H2 |
| InChIKey | LDWUZEUGZYITBJ-UHFFFAOYSA-N |
| XLogP | -1.43 |
| TPSA | 86.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[13-(2-aminoethyl)-1,4,10-trioxa-7,13-diazacyclopentadec-7-yl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[13-(2-aminoethyl)-1,4,10-trioxa-7,13-diazacyclopentadec-7-yl]ethanamine?
The IUPAC name of 2-[13-(2-aminoethyl)-1,4,10-trioxa-7,13-diazacyclopentadec-7-yl]ethanamine (CID 86006351) is 2-[13-(2-aminoethyl)-1,4,10-trioxa-7,13-diazacyclopentadec-7-yl]ethanamine.
What is the SMILES notation for 2-[13-(2-aminoethyl)-1,4,10-trioxa-7,13-diazacyclopentadec-7-yl]ethanamine?
The canonical SMILES for 2-[13-(2-aminoethyl)-1,4,10-trioxa-7,13-diazacyclopentadec-7-yl]ethanamine is NCCN1CCOCCOCCN(CCN)CCOCC1.
What is the InChIKey of 2-[13-(2-aminoethyl)-1,4,10-trioxa-7,13-diazacyclopentadec-7-yl]ethanamine?
The InChIKey is LDWUZEUGZYITBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H32N4O3/c15-1-3-17-5-9-19-10-6-18(4-2-16)8-12-21-14-13-20-11-7-17/h1-16H2.
What are the key properties of 2-[13-(2-aminoethyl)-1,4,10-trioxa-7,13-diazacyclopentadec-7-yl]ethanamine?
2-[13-(2-aminoethyl)-1,4,10-trioxa-7,13-diazacyclopentadec-7-yl]ethanamine has a molecular weight of 304.44 g/mol, XLogP of -1.43, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[13-(2-aminoethyl)-1,4,10-trioxa-7,13-diazacyclopentadec-7-yl]ethanamine is sourced from PubChem (CID 86006351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).