About 3-[2,3-dihydroxypropylsulfanyl(dimethyl)stannyl]sulfanylpropane-1,2-diol
3-[2,3-dihydroxypropylsulfanyl(dimethyl)stannyl]sulfanylpropane-1,2-diol (PubChem CID 86008094) has the molecular formula C8H20O4S2Sn
and a molecular weight of 363.09 g/mol. Its IUPAC name is 3-[2,3-dihydroxypropylsulfanyl(dimethyl)stannyl]sulfanylpropane-1,2-diol.
Molecular Properties
| Compound Name | 3-[2,3-dihydroxypropylsulfanyl(dimethyl)stannyl]sulfanylpropane-1,2-diol |
| PubChem CID | 86008094 |
| Molecular Formula | C8H20O4S2Sn |
| Molecular Weight | 363.09 g/mol |
| Exact Mass | 363.98 |
| IUPAC Name | 3-[2,3-dihydroxypropylsulfanyl(dimethyl)stannyl]sulfanylpropane-1,2-diol |
| SMILES | C[Sn](C)(SCC(O)CO)SCC(O)CO |
| InChI | InChI=1S/2C3H8O2S.2CH3.Sn/c2*4-1-3(5)2-6;;;/h2*3-6H,1-2H2;2*1H3;/q;;;;+2/p-2 |
| InChIKey | ZMTXELWPEWADKZ-UHFFFAOYSA-L |
| XLogP | -0.14 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.09 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[2,3-dihydroxypropylsulfanyl(dimethyl)stannyl]sulfanylpropane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2,3-dihydroxypropylsulfanyl(dimethyl)stannyl]sulfanylpropane-1,2-diol?
The IUPAC name of 3-[2,3-dihydroxypropylsulfanyl(dimethyl)stannyl]sulfanylpropane-1,2-diol (CID 86008094) is 3-[2,3-dihydroxypropylsulfanyl(dimethyl)stannyl]sulfanylpropane-1,2-diol.
What is the SMILES notation for 3-[2,3-dihydroxypropylsulfanyl(dimethyl)stannyl]sulfanylpropane-1,2-diol?
The canonical SMILES for 3-[2,3-dihydroxypropylsulfanyl(dimethyl)stannyl]sulfanylpropane-1,2-diol is C[Sn](C)(SCC(O)CO)SCC(O)CO.
What is the InChIKey of 3-[2,3-dihydroxypropylsulfanyl(dimethyl)stannyl]sulfanylpropane-1,2-diol?
The InChIKey is ZMTXELWPEWADKZ-UHFFFAOYSA-L. The full InChI is InChI=1S/2C3H8O2S.2CH3.Sn/c2*4-1-3(5)2-6;;;/h2*3-6H,1-2H2;2*1H3;/q;;;;+2/p-2.
What are the key properties of 3-[2,3-dihydroxypropylsulfanyl(dimethyl)stannyl]sulfanylpropane-1,2-diol?
3-[2,3-dihydroxypropylsulfanyl(dimethyl)stannyl]sulfanylpropane-1,2-diol has a molecular weight of 363.09 g/mol, XLogP of -0.14, 8 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2,3-dihydroxypropylsulfanyl(dimethyl)stannyl]sulfanylpropane-1,2-diol is sourced from PubChem (CID 86008094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).