About 2,4-dimethyl-2,6-diphenylthiopyran
2,4-dimethyl-2,6-diphenylthiopyran (PubChem CID 86008412) has the molecular formula C19H18S
and a molecular weight of 278.42 g/mol. Its IUPAC name is 2,4-dimethyl-2,6-diphenylthiopyran.
Molecular Properties
| Compound Name | 2,4-dimethyl-2,6-diphenylthiopyran |
| PubChem CID | 86008412 |
| Molecular Formula | C19H18S |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 2,4-dimethyl-2,6-diphenylthiopyran |
| SMILES | CC1=CC(C)(c2ccccc2)SC(c2ccccc2)=C1 |
| InChI | InChI=1S/C19H18S/c1-15-13-18(16-9-5-3-6-10-16)20-19(2,14-15)17-11-7-4-8-12-17/h3-14H,1-2H3 |
| InChIKey | UXFJXZPVKOIVCX-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,4-dimethyl-2,6-diphenylthiopyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethyl-2,6-diphenylthiopyran?
The IUPAC name of 2,4-dimethyl-2,6-diphenylthiopyran (CID 86008412) is 2,4-dimethyl-2,6-diphenylthiopyran.
What is the SMILES notation for 2,4-dimethyl-2,6-diphenylthiopyran?
The canonical SMILES for 2,4-dimethyl-2,6-diphenylthiopyran is CC1=CC(C)(c2ccccc2)SC(c2ccccc2)=C1.
What is the InChIKey of 2,4-dimethyl-2,6-diphenylthiopyran?
The InChIKey is UXFJXZPVKOIVCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18S/c1-15-13-18(16-9-5-3-6-10-16)20-19(2,14-15)17-11-7-4-8-12-17/h3-14H,1-2H3.
What are the key properties of 2,4-dimethyl-2,6-diphenylthiopyran?
2,4-dimethyl-2,6-diphenylthiopyran has a molecular weight of 278.42 g/mol, XLogP of 5.64, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethyl-2,6-diphenylthiopyran is sourced from PubChem (CID 86008412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).