C17H17N — CID 86009480
6-(2-phenylphenyl)-2,3,4,5-tetrahydropyridine (PubChem CID 86009480) has the molecular formula C17H17N and a molecular weight of 235.33 g/mol. Its IUPAC name is 6-(2-phenylphenyl)-2,3,4,5-tetrahydropyridine.
| Compound Name | 6-(2-phenylphenyl)-2,3,4,5-tetrahydropyridine |
|---|---|
| PubChem CID | 86009480 |
| Molecular Formula | C17H17N |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | 6-(2-phenylphenyl)-2,3,4,5-tetrahydropyridine |
| SMILES | c1ccc(-c2ccccc2C2=NCCCC2)cc1 |
| InChI | InChI=1S/C17H17N/c1-2-8-14(9-3-1)15-10-4-5-11-16(15)17-12-6-7-13-18-17/h1-5,8-11H,6-7,12-13H2 |
| InChIKey | HKUUGJJDMZPJOU-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |