About 5-acetyl-3,7-diphenylfuro[2,3-f]indole-2,6-dione
5-acetyl-3,7-diphenylfuro[2,3-f]indole-2,6-dione (PubChem CID 86010332) has the molecular formula C24H15NO4
and a molecular weight of 381.39 g/mol. Its IUPAC name is 5-acetyl-3,7-diphenylfuro[2,3-f]indole-2,6-dione.
Molecular Properties
| Compound Name | 5-acetyl-3,7-diphenylfuro[2,3-f]indole-2,6-dione |
| PubChem CID | 86010332 |
| Molecular Formula | C24H15NO4 |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | 5-acetyl-3,7-diphenylfuro[2,3-f]indole-2,6-dione |
| SMILES | CC(=O)N1C(=O)C(c2ccccc2)=c2cc3c(cc21)=C(c1ccccc1)C(=O)O3 |
| InChI | InChI=1S/C24H15NO4/c1-14(26)25-19-12-18-20(29-24(28)22(18)16-10-6-3-7-11-16)13-17(19)21(23(25)27)15-8-4-2-5-9-15/h2-13H,1H3 |
| InChIKey | GQBBXGHCVOJXJW-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 5-acetyl-3,7-diphenylfuro[2,3-f]indole-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-acetyl-3,7-diphenylfuro[2,3-f]indole-2,6-dione?
The IUPAC name of 5-acetyl-3,7-diphenylfuro[2,3-f]indole-2,6-dione (CID 86010332) is 5-acetyl-3,7-diphenylfuro[2,3-f]indole-2,6-dione.
What is the SMILES notation for 5-acetyl-3,7-diphenylfuro[2,3-f]indole-2,6-dione?
The canonical SMILES for 5-acetyl-3,7-diphenylfuro[2,3-f]indole-2,6-dione is CC(=O)N1C(=O)C(c2ccccc2)=c2cc3c(cc21)=C(c1ccccc1)C(=O)O3.
What is the InChIKey of 5-acetyl-3,7-diphenylfuro[2,3-f]indole-2,6-dione?
The InChIKey is GQBBXGHCVOJXJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H15NO4/c1-14(26)25-19-12-18-20(29-24(28)22(18)16-10-6-3-7-11-16)13-17(19)21(23(25)27)15-8-4-2-5-9-15/h2-13H,1H3.
What are the key properties of 5-acetyl-3,7-diphenylfuro[2,3-f]indole-2,6-dione?
5-acetyl-3,7-diphenylfuro[2,3-f]indole-2,6-dione has a molecular weight of 381.39 g/mol, XLogP of 1.90, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-acetyl-3,7-diphenylfuro[2,3-f]indole-2,6-dione is sourced from PubChem (CID 86010332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).