About N-ethyl-2-oxo-1,3-benzothiazole-3-carboxamide
N-ethyl-2-oxo-1,3-benzothiazole-3-carboxamide (PubChem CID 86011028) has the molecular formula C10H10N2O2S
and a molecular weight of 222.27 g/mol. Its IUPAC name is N-ethyl-2-oxo-1,3-benzothiazole-3-carboxamide.
Molecular Properties
| Compound Name | N-ethyl-2-oxo-1,3-benzothiazole-3-carboxamide |
| PubChem CID | 86011028 |
| Molecular Formula | C10H10N2O2S |
| Molecular Weight | 222.27 g/mol |
| Exact Mass | 222.05 |
| IUPAC Name | N-ethyl-2-oxo-1,3-benzothiazole-3-carboxamide |
| SMILES | CCNC(=O)n1c(=O)sc2ccccc21 |
| InChI | InChI=1S/C10H10N2O2S/c1-2-11-9(13)12-7-5-3-4-6-8(7)15-10(12)14/h3-6H,2H2,1H3,(H,11,13) |
| InChIKey | IZXZVCSSXKOIEL-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.27 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-ethyl-2-oxo-1,3-benzothiazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-2-oxo-1,3-benzothiazole-3-carboxamide?
The IUPAC name of N-ethyl-2-oxo-1,3-benzothiazole-3-carboxamide (CID 86011028) is N-ethyl-2-oxo-1,3-benzothiazole-3-carboxamide.
What is the SMILES notation for N-ethyl-2-oxo-1,3-benzothiazole-3-carboxamide?
The canonical SMILES for N-ethyl-2-oxo-1,3-benzothiazole-3-carboxamide is CCNC(=O)n1c(=O)sc2ccccc21.
What is the InChIKey of N-ethyl-2-oxo-1,3-benzothiazole-3-carboxamide?
The InChIKey is IZXZVCSSXKOIEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O2S/c1-2-11-9(13)12-7-5-3-4-6-8(7)15-10(12)14/h3-6H,2H2,1H3,(H,11,13).
What are the key properties of N-ethyl-2-oxo-1,3-benzothiazole-3-carboxamide?
N-ethyl-2-oxo-1,3-benzothiazole-3-carboxamide has a molecular weight of 222.27 g/mol, XLogP of 1.64, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-2-oxo-1,3-benzothiazole-3-carboxamide is sourced from PubChem (CID 86011028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).