C14H15N7OS2 — CID 8601176
10-[(4,6-diamino-1,3,5-triazin-2-yl)methylsulfanyl]-11-methyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-12-one (PubChem CID 8601176) has the molecular formula C14H15N7OS2 and a molecular weight of 361.46 g/mol. Its IUPAC name is 10-[(4,6-diamino-1,3,5-triazin-2-yl)methylsulfanyl]-11-methyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-12-one.
| Compound Name | 10-[(4,6-diamino-1,3,5-triazin-2-yl)methylsulfanyl]-11-methyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-12-one |
|---|---|
| PubChem CID | 8601176 |
| Molecular Formula | C14H15N7OS2 |
| Molecular Weight | 361.46 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | 10-[(4,6-diamino-1,3,5-triazin-2-yl)methylsulfanyl]-11-methyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-12-one |
| SMILES | Cn1c(SCc2nc(N)nc(N)n2)nc2sc3c(c2c1=O)CCC3 |
| InChI | InChI=1S/C14H15N7OS2/c1-21-11(22)9-6-3-2-4-7(6)24-10(9)19-14(21)23-5-8-17-12(15)20-13(16)18-8/h2-5H2,1H3,(H4,15,16,17,18,20) |
| InChIKey | SAJVYXSPAGNZGZ-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 125.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.46 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |