About 3-methyl-1-oxido-2,4-dihydroimidazol-1-ium
3-methyl-1-oxido-2,4-dihydroimidazol-1-ium (PubChem CID 86012002) has the molecular formula C4H8N2O
and a molecular weight of 100.12 g/mol. Its IUPAC name is 3-methyl-1-oxido-2,4-dihydroimidazol-1-ium.
Molecular Properties
| Compound Name | 3-methyl-1-oxido-2,4-dihydroimidazol-1-ium |
| PubChem CID | 86012002 |
| Molecular Formula | C4H8N2O |
| Molecular Weight | 100.12 g/mol |
| Exact Mass | 100.06 |
| IUPAC Name | 3-methyl-1-oxido-2,4-dihydroimidazol-1-ium |
| SMILES | CN1CC=[N+]([O-])C1 |
| InChI | InChI=1S/C4H8N2O/c1-5-2-3-6(7)4-5/h3H,2,4H2,1H3 |
| InChIKey | ORBHLYOLBFAWLZ-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 29.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 100.12 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-1-oxido-2,4-dihydroimidazol-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-1-oxido-2,4-dihydroimidazol-1-ium?
The IUPAC name of 3-methyl-1-oxido-2,4-dihydroimidazol-1-ium (CID 86012002) is 3-methyl-1-oxido-2,4-dihydroimidazol-1-ium.
What is the SMILES notation for 3-methyl-1-oxido-2,4-dihydroimidazol-1-ium?
The canonical SMILES for 3-methyl-1-oxido-2,4-dihydroimidazol-1-ium is CN1CC=[N+]([O-])C1.
What is the InChIKey of 3-methyl-1-oxido-2,4-dihydroimidazol-1-ium?
The InChIKey is ORBHLYOLBFAWLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8N2O/c1-5-2-3-6(7)4-5/h3H,2,4H2,1H3.
What are the key properties of 3-methyl-1-oxido-2,4-dihydroimidazol-1-ium?
3-methyl-1-oxido-2,4-dihydroimidazol-1-ium has a molecular weight of 100.12 g/mol, XLogP of -0.53, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-1-oxido-2,4-dihydroimidazol-1-ium is sourced from PubChem (CID 86012002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).