About N,N-dimethylformamide;dihydrate
N,N-dimethylformamide;dihydrate (PubChem CID 86012004) has the molecular formula C3H11NO3
and a molecular weight of 109.12 g/mol. Its IUPAC name is N,N-dimethylformamide;dihydrate.
Molecular Properties
| Compound Name | N,N-dimethylformamide;dihydrate |
| PubChem CID | 86012004 |
| Molecular Formula | C3H11NO3 |
| Molecular Weight | 109.12 g/mol |
| Exact Mass | 109.07 |
| IUPAC Name | N,N-dimethylformamide;dihydrate |
| SMILES | CN(C)C=O.O.O |
| InChI | InChI=1S/C3H7NO.2H2O/c1-4(2)3-5;;/h3H,1-2H3;2*1H2 |
| InChIKey | YXLFCICVCJCCKR-UHFFFAOYSA-N |
| XLogP | -1.95 |
| TPSA | 83.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 109.12 |
| LogP ≤ 5 | -1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethylformamide;dihydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylformamide;dihydrate?
The IUPAC name of N,N-dimethylformamide;dihydrate (CID 86012004) is N,N-dimethylformamide;dihydrate.
What is the SMILES notation for N,N-dimethylformamide;dihydrate?
The canonical SMILES for N,N-dimethylformamide;dihydrate is CN(C)C=O.O.O.
What is the InChIKey of N,N-dimethylformamide;dihydrate?
The InChIKey is YXLFCICVCJCCKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7NO.2H2O/c1-4(2)3-5;;/h3H,1-2H3;2*1H2.
What are the key properties of N,N-dimethylformamide;dihydrate?
N,N-dimethylformamide;dihydrate has a molecular weight of 109.12 g/mol, XLogP of -1.95, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylformamide;dihydrate is sourced from PubChem (CID 86012004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).