About 1-methoxy-3-methyl-5,7-di(propan-2-ylidene)cycloheptene
1-methoxy-3-methyl-5,7-di(propan-2-ylidene)cycloheptene (PubChem CID 86012150) has the molecular formula C15H24O
and a molecular weight of 220.36 g/mol. Its IUPAC name is 1-methoxy-3-methyl-5,7-di(propan-2-ylidene)cycloheptene.
Molecular Properties
| Compound Name | 1-methoxy-3-methyl-5,7-di(propan-2-ylidene)cycloheptene |
| PubChem CID | 86012150 |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | 1-methoxy-3-methyl-5,7-di(propan-2-ylidene)cycloheptene |
| SMILES | COC1=CC(C)CC(=C(C)C)CC1=C(C)C |
| InChI | InChI=1S/C15H24O/c1-10(2)13-7-12(5)8-15(16-6)14(9-13)11(3)4/h8,12H,7,9H2,1-6H3 |
| InChIKey | MMNSNNPCGNVBRR-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-methoxy-3-methyl-5,7-di(propan-2-ylidene)cycloheptene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxy-3-methyl-5,7-di(propan-2-ylidene)cycloheptene?
The IUPAC name of 1-methoxy-3-methyl-5,7-di(propan-2-ylidene)cycloheptene (CID 86012150) is 1-methoxy-3-methyl-5,7-di(propan-2-ylidene)cycloheptene.
What is the SMILES notation for 1-methoxy-3-methyl-5,7-di(propan-2-ylidene)cycloheptene?
The canonical SMILES for 1-methoxy-3-methyl-5,7-di(propan-2-ylidene)cycloheptene is COC1=CC(C)CC(=C(C)C)CC1=C(C)C.
What is the InChIKey of 1-methoxy-3-methyl-5,7-di(propan-2-ylidene)cycloheptene?
The InChIKey is MMNSNNPCGNVBRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24O/c1-10(2)13-7-12(5)8-15(16-6)14(9-13)11(3)4/h8,12H,7,9H2,1-6H3.
What are the key properties of 1-methoxy-3-methyl-5,7-di(propan-2-ylidene)cycloheptene?
1-methoxy-3-methyl-5,7-di(propan-2-ylidene)cycloheptene has a molecular weight of 220.36 g/mol, XLogP of 4.62, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxy-3-methyl-5,7-di(propan-2-ylidene)cycloheptene is sourced from PubChem (CID 86012150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).