About tridec-6-yn-3-one
tridec-6-yn-3-one (PubChem CID 86013605) has the molecular formula C13H22O
and a molecular weight of 194.32 g/mol. Its IUPAC name is tridec-6-yn-3-one.
Molecular Properties
| Compound Name | tridec-6-yn-3-one |
| PubChem CID | 86013605 |
| Molecular Formula | C13H22O |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.17 |
| IUPAC Name | tridec-6-yn-3-one |
| SMILES | CCCCCCC#CCCC(=O)CC |
| InChI | InChI=1S/C13H22O/c1-3-5-6-7-8-9-10-11-12-13(14)4-2/h3-8,11-12H2,1-2H3 |
| InChIKey | IEWBRSPTXFXBRP-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze tridec-6-yn-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tridec-6-yn-3-one?
The IUPAC name of tridec-6-yn-3-one (CID 86013605) is tridec-6-yn-3-one.
What is the SMILES notation for tridec-6-yn-3-one?
The canonical SMILES for tridec-6-yn-3-one is CCCCCCC#CCCC(=O)CC.
What is the InChIKey of tridec-6-yn-3-one?
The InChIKey is IEWBRSPTXFXBRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22O/c1-3-5-6-7-8-9-10-11-12-13(14)4-2/h3-8,11-12H2,1-2H3.
What are the key properties of tridec-6-yn-3-one?
tridec-6-yn-3-one has a molecular weight of 194.32 g/mol, XLogP of 3.72, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tridec-6-yn-3-one is sourced from PubChem (CID 86013605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).