C5H17N5 — CID 86014297
pentane-1,2,3,4,5-pentamine (PubChem CID 86014297) has the molecular formula C5H17N5 and a molecular weight of 147.23 g/mol. Its IUPAC name is pentane-1,2,3,4,5-pentamine.
| Compound Name | pentane-1,2,3,4,5-pentamine |
|---|---|
| PubChem CID | 86014297 |
| Molecular Formula | C5H17N5 |
| Molecular Weight | 147.23 g/mol |
| Exact Mass | 147.15 |
| IUPAC Name | pentane-1,2,3,4,5-pentamine |
| SMILES | NCC(N)C(N)C(N)CN |
| InChI | InChI=1S/C5H17N5/c6-1-3(8)5(10)4(9)2-7/h3-5H,1-2,6-10H2 |
| InChIKey | VXYOTPRQVJDCET-UHFFFAOYSA-N |
| XLogP | -3.11 |
| TPSA | 130.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.23 |
| LogP ≤ 5 | -3.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |