About phenyl 2-ethylpent-4-enoate
phenyl 2-ethylpent-4-enoate (PubChem CID 86014325) has the molecular formula C13H16O2
and a molecular weight of 204.27 g/mol. Its IUPAC name is phenyl 2-ethylpent-4-enoate.
Molecular Properties
| Compound Name | phenyl 2-ethylpent-4-enoate |
| PubChem CID | 86014325 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | phenyl 2-ethylpent-4-enoate |
| SMILES | C=CCC(CC)C(=O)Oc1ccccc1 |
| InChI | InChI=1S/C13H16O2/c1-3-8-11(4-2)13(14)15-12-9-6-5-7-10-12/h3,5-7,9-11H,1,4,8H2,2H3 |
| InChIKey | RNSCQLWEYJCLOF-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze phenyl 2-ethylpent-4-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl 2-ethylpent-4-enoate?
The IUPAC name of phenyl 2-ethylpent-4-enoate (CID 86014325) is phenyl 2-ethylpent-4-enoate.
What is the SMILES notation for phenyl 2-ethylpent-4-enoate?
The canonical SMILES for phenyl 2-ethylpent-4-enoate is C=CCC(CC)C(=O)Oc1ccccc1.
What is the InChIKey of phenyl 2-ethylpent-4-enoate?
The InChIKey is RNSCQLWEYJCLOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O2/c1-3-8-11(4-2)13(14)15-12-9-6-5-7-10-12/h3,5-7,9-11H,1,4,8H2,2H3.
What are the key properties of phenyl 2-ethylpent-4-enoate?
phenyl 2-ethylpent-4-enoate has a molecular weight of 204.27 g/mol, XLogP of 3.19, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl 2-ethylpent-4-enoate is sourced from PubChem (CID 86014325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).